C11H7N5S — CID 123390487
5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-1,3-thiazol-2-amine (PubChem CID 123390487) has the molecular formula C11H7N5S and a molecular weight of 241.28 g/mol. Its IUPAC name is 5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 123390487 |
| Molecular Formula | C11H7N5S |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 5-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(C#Cc2cnc3cccnn23)s1 |
| InChI | InChI=1S/C11H7N5S/c12-11-14-7-9(17-11)4-3-8-6-13-10-2-1-5-15-16(8)10/h1-2,5-7H,(H2,12,14) |
| InChIKey | WPGHSDRLUFAWIK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|