About 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile
6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile (PubChem CID 594341) has the molecular formula C7H5N5
and a molecular weight of 159.15 g/mol. Its IUPAC name is 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile.
Molecular Properties
| Compound Name | 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile |
| PubChem CID | 594341 |
| Molecular Formula | C7H5N5 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile |
| SMILES | N#Cc1c(N)cnc2ccnn12 |
| InChI | InChI=1S/C7H5N5/c8-3-6-5(9)4-10-7-1-2-11-12(6)7/h1-2,4H,9H2 |
| InChIKey | DVWWNQQFZHAOAS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile?
The IUPAC name of 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile (CID 594341) is 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile.
What is the SMILES notation for 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile?
The canonical SMILES for 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile is N#Cc1c(N)cnc2ccnn12.
What is the InChIKey of 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile?
The InChIKey is DVWWNQQFZHAOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5/c8-3-6-5(9)4-10-7-1-2-11-12(6)7/h1-2,4H,9H2.
What are the key properties of 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile?
6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile has a molecular weight of 159.15 g/mol, XLogP of 0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminopyrazolo[1,5-a]pyrimidine-7-carbonitrile is sourced from PubChem (CID 594341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).