C23H32N4O5S — CID 123391887
2-phenylmethoxyethyl N-[2-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-2-carbonylamino)thiolane-3-carbonyl]carbamate (PubChem CID 123391887) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-phenylmethoxyethyl N-[2-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-2-carbonylamino)thiolane-3-carbonyl]carbamate.
| Compound Name | 2-phenylmethoxyethyl N-[2-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-2-carbonylamino)thiolane-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 123391887 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-phenylmethoxyethyl N-[2-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-2-carbonylamino)thiolane-3-carbonyl]carbamate |
| SMILES | O=C(NC(=O)C1CCSC1NC(=O)C1CN2CCCCC2N1)OCCOCc1ccccc1 |
| InChI | InChI=1S/C23H32N4O5S/c28-20(26-23(30)32-12-11-31-15-16-6-2-1-3-7-16)17-9-13-33-22(17)25-21(29)18-14-27-10-5-4-8-19(27)24-18/h1-3,6-7,17-19,22,24H,4-5,8-15H2,(H,25,29)(H,26,28,30) |
| InChIKey | MHNGFSPJKBOISS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|