C25H21F — CID 123393655
1-fluoro-5-methyl-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]-3-prop-2-enylbenzene (PubChem CID 123393655) has the molecular formula C25H21F and a molecular weight of 340.44 g/mol. Its IUPAC name is 1-fluoro-5-methyl-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]-3-prop-2-enylbenzene.
| Compound Name | 1-fluoro-5-methyl-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]-3-prop-2-enylbenzene |
|---|---|
| PubChem CID | 123393655 |
| Molecular Formula | C25H21F |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-fluoro-5-methyl-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]-3-prop-2-enylbenzene |
| SMILES | C=CCc1cc(C)cc(F)c1C#Cc1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H21F/c1-4-5-23-16-19(3)17-25(26)24(23)15-10-20-8-13-22(14-9-20)21-11-6-18(2)7-12-21/h4,6-9,11-14,16-17H,1,5H2,2-3H3 |
| InChIKey | RMUAWDYAONJHQB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|