C16H18N5O3+ — CID 123394749
methyl 6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-7H-purin-9-ium-2-carboxylate (PubChem CID 123394749) has the molecular formula C16H18N5O3+ and a molecular weight of 328.35 g/mol. Its IUPAC name is methyl 6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-7H-purin-9-ium-2-carboxylate.
| Compound Name | methyl 6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-7H-purin-9-ium-2-carboxylate |
|---|---|
| PubChem CID | 123394749 |
| Molecular Formula | C16H18N5O3+ |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | methyl 6-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-7H-purin-9-ium-2-carboxylate |
| SMILES | COC(=O)c1nc(N[C@H](CO)Cc2ccccc2)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C16H17N5O3/c1-24-16(23)15-20-13-12(17-9-18-13)14(21-15)19-11(8-22)7-10-5-3-2-4-6-10/h2-6,9,11,22H,7-8H2,1H3,(H2,17,18,19,20,21)/p+1/t11-/m0/s1 |
| InChIKey | MIGOWQFQSIGXMT-NSHDSACASA-O |
| XLogP | 0.57 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |