C9H13N — CID 123397587
4-methyl-3a,4,5,7a-tetrahydro-3H-indole (PubChem CID 123397587) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 4-methyl-3a,4,5,7a-tetrahydro-3H-indole.
| Compound Name | 4-methyl-3a,4,5,7a-tetrahydro-3H-indole |
|---|---|
| PubChem CID | 123397587 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 4-methyl-3a,4,5,7a-tetrahydro-3H-indole |
| SMILES | CC1CC=CC2N=CCC12 |
| InChI | InChI=1S/C9H13N/c1-7-3-2-4-9-8(7)5-6-10-9/h2,4,6-9H,3,5H2,1H3 |
| InChIKey | UNCJVSDYBCDNOJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|