C12H21N — CID 123398582
N-[(1Z,3E)-2-methylhexa-1,3-dienyl]pentan-3-imine (PubChem CID 123398582) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is N-[(1Z,3E)-2-methylhexa-1,3-dienyl]pentan-3-imine.
| Compound Name | N-[(1Z,3E)-2-methylhexa-1,3-dienyl]pentan-3-imine |
|---|---|
| PubChem CID | 123398582 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-[(1Z,3E)-2-methylhexa-1,3-dienyl]pentan-3-imine |
| SMILES | CC/C=C/C(C)=C\N=C(CC)CC |
| InChI | InChI=1S/C12H21N/c1-5-8-9-11(4)10-13-12(6-2)7-3/h8-10H,5-7H2,1-4H3/b9-8+,11-10- |
| InChIKey | VUKBIIMUOZTJGI-OCBXPSTGSA-N |
| XLogP | 4.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|