C5H12OSi2 — CID 123402874
penta-1,4-dien-2-yl(silyloxy)silane (PubChem CID 123402874) has the molecular formula C5H12OSi2 and a molecular weight of 144.32 g/mol. Its IUPAC name is penta-1,4-dien-2-yl(silyloxy)silane.
| Compound Name | penta-1,4-dien-2-yl(silyloxy)silane |
|---|---|
| PubChem CID | 123402874 |
| Molecular Formula | C5H12OSi2 |
| Molecular Weight | 144.32 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | penta-1,4-dien-2-yl(silyloxy)silane |
| SMILES | C=CCC(=C)[SiH2]O[SiH3] |
| InChI | InChI=1S/C5H12OSi2/c1-3-4-5(2)8-6-7/h3H,1-2,4,8H2,7H3 |
| InChIKey | SOQGJRWBQDVBST-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|