C25H24F2N2O2+2 — CID 123405362
3-(7,7-diethyl-9,11-difluoro-6H-benzo[a]quinolizin-5-ium-6-yl)-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one (PubChem CID 123405362) has the molecular formula C25H24F2N2O2+2 and a molecular weight of 422.48 g/mol. Its IUPAC name is 3-(7,7-diethyl-9,11-difluoro-6H-benzo[a]quinolizin-5-ium-6-yl)-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one.
| Compound Name | 3-(7,7-diethyl-9,11-difluoro-6H-benzo[a]quinolizin-5-ium-6-yl)-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one |
|---|---|
| PubChem CID | 123405362 |
| Molecular Formula | C25H24F2N2O2+2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-(7,7-diethyl-9,11-difluoro-6H-benzo[a]quinolizin-5-ium-6-yl)-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one |
| SMILES | CCC1(CC)c2cc(F)cc(F)c2-c2cccc[n+]2C1C1C[n+]2ccccc2C(=O)O1 |
| InChI | InChI=1S/C25H24F2N2O2/c1-3-25(4-2)17-13-16(26)14-18(27)22(17)19-9-6-8-12-29(19)23(25)21-15-28-11-7-5-10-20(28)24(30)31-21/h5-14,21,23H,3-4,15H2,1-2H3/q+2 |
| InChIKey | XLMLGDORJWDXGP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|