C15H24N6O — CID 123415453
N-tert-butyl-6-[3-(methoxymethyl)-3-methylazetidin-1-yl]-7H-purin-2-amine (PubChem CID 123415453) has the molecular formula C15H24N6O and a molecular weight of 304.40 g/mol. Its IUPAC name is N-tert-butyl-6-[3-(methoxymethyl)-3-methylazetidin-1-yl]-7H-purin-2-amine.
| Compound Name | N-tert-butyl-6-[3-(methoxymethyl)-3-methylazetidin-1-yl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 123415453 |
| Molecular Formula | C15H24N6O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | N-tert-butyl-6-[3-(methoxymethyl)-3-methylazetidin-1-yl]-7H-purin-2-amine |
| SMILES | COCC1(C)CN(c2nc(NC(C)(C)C)nc3nc[nH]c23)C1 |
| InChI | InChI=1S/C15H24N6O/c1-14(2,3)20-13-18-11-10(16-9-17-11)12(19-13)21-6-15(4,7-21)8-22-5/h9H,6-8H2,1-5H3,(H2,16,17,18,19,20) |
| InChIKey | IQPLIJPKYHVZCN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |