C40H42O6S2 — CID 123421093
[6-[4-(4-benzoylphenyl)sulfanyl-2-methyl-3-oxobutan-2-yl]oxy-2-methylhexan-2-yl] 2-(4-benzoylphenyl)sulfanylacetate (PubChem CID 123421093) has the molecular formula C40H42O6S2 and a molecular weight of 682.90 g/mol. Its IUPAC name is [6-[4-(4-benzoylphenyl)sulfanyl-2-methyl-3-oxobutan-2-yl]oxy-2-methylhexan-2-yl] 2-(4-benzoylphenyl)sulfanylacetate.
| Compound Name | [6-[4-(4-benzoylphenyl)sulfanyl-2-methyl-3-oxobutan-2-yl]oxy-2-methylhexan-2-yl] 2-(4-benzoylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 123421093 |
| Molecular Formula | C40H42O6S2 |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.24 |
| IUPAC Name | [6-[4-(4-benzoylphenyl)sulfanyl-2-methyl-3-oxobutan-2-yl]oxy-2-methylhexan-2-yl] 2-(4-benzoylphenyl)sulfanylacetate |
| SMILES | CC(C)(CCCCOC(C)(C)C(=O)CSc1ccc(C(=O)c2ccccc2)cc1)OC(=O)CSc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H42O6S2/c1-39(2,46-36(42)28-48-34-23-19-32(20-24-34)38(44)30-15-9-6-10-16-30)25-11-12-26-45-40(3,4)35(41)27-47-33-21-17-31(18-22-33)37(43)29-13-7-5-8-14-29/h5-10,13-24H,11-12,25-28H2,1-4H3 |
| InChIKey | YKGGLDRCRMXHMD-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|