C23H32N3O5+ — CID 123428820
(1-methylcyclopropyl) 4-[4-(3-cyano-1-methoxypyridin-1-ium-4-yl)oxycyclohexyl]oxypiperidine-1-carboxylate (PubChem CID 123428820) has the molecular formula C23H32N3O5+ and a molecular weight of 430.53 g/mol. Its IUPAC name is (1-methylcyclopropyl) 4-[4-(3-cyano-1-methoxypyridin-1-ium-4-yl)oxycyclohexyl]oxypiperidine-1-carboxylate.
| Compound Name | (1-methylcyclopropyl) 4-[4-(3-cyano-1-methoxypyridin-1-ium-4-yl)oxycyclohexyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123428820 |
| Molecular Formula | C23H32N3O5+ |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (1-methylcyclopropyl) 4-[4-(3-cyano-1-methoxypyridin-1-ium-4-yl)oxycyclohexyl]oxypiperidine-1-carboxylate |
| SMILES | CO[n+]1ccc(OC2CCC(OC3CCN(C(=O)OC4(C)CC4)CC3)CC2)c(C#N)c1 |
| InChI | InChI=1S/C23H32N3O5/c1-23(10-11-23)31-22(27)25-12-7-20(8-13-25)29-18-3-5-19(6-4-18)30-21-9-14-26(28-2)16-17(21)15-24/h9,14,16,18-20H,3-8,10-13H2,1-2H3/q+1 |
| InChIKey | FFCDXCYGITWSGS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|