C22H29N3O5 — CID 71491424
(1-methylcyclopropyl) 4-[4-(3-cyano-1-oxidopyridin-1-ium-4-yl)oxycyclohexyl]oxypiperidine-1-carboxylate (PubChem CID 71491424) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is (1-methylcyclopropyl) 4-[4-(3-cyano-1-oxidopyridin-1-ium-4-yl)oxycyclohexyl]oxypiperidine-1-carboxylate.
| Compound Name | (1-methylcyclopropyl) 4-[4-(3-cyano-1-oxidopyridin-1-ium-4-yl)oxycyclohexyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 71491424 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (1-methylcyclopropyl) 4-[4-(3-cyano-1-oxidopyridin-1-ium-4-yl)oxycyclohexyl]oxypiperidine-1-carboxylate |
| SMILES | CC1(OC(=O)N2CCC(OC3CCC(Oc4cc[n+]([O-])cc4C#N)CC3)CC2)CC1 |
| InChI | InChI=1S/C22H29N3O5/c1-22(9-10-22)30-21(26)24-11-6-19(7-12-24)28-17-2-4-18(5-3-17)29-20-8-13-25(27)15-16(20)14-23/h8,13,15,17-19H,2-7,9-12H2,1H3 |
| InChIKey | MOFHDWQRSSCCSH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 98.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|