C14H16ClF3N4 — CID 123431756
2-chloro-6-[[3,3-difluoro-2-(methylamino)cyclohexyl]-methylamino]-5-fluoropyridine-3-carbonitrile (PubChem CID 123431756) has the molecular formula C14H16ClF3N4 and a molecular weight of 332.76 g/mol. Its IUPAC name is 2-chloro-6-[[3,3-difluoro-2-(methylamino)cyclohexyl]-methylamino]-5-fluoropyridine-3-carbonitrile.
| Compound Name | 2-chloro-6-[[3,3-difluoro-2-(methylamino)cyclohexyl]-methylamino]-5-fluoropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 123431756 |
| Molecular Formula | C14H16ClF3N4 |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-chloro-6-[[3,3-difluoro-2-(methylamino)cyclohexyl]-methylamino]-5-fluoropyridine-3-carbonitrile |
| SMILES | CNC1C(N(C)c2nc(Cl)c(C#N)cc2F)CCCC1(F)F |
| InChI | InChI=1S/C14H16ClF3N4/c1-20-11-10(4-3-5-14(11,17)18)22(2)13-9(16)6-8(7-19)12(15)21-13/h6,10-11,20H,3-5H2,1-2H3 |
| InChIKey | GWNPTLDEOJFYPK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|