C19H28N2O5 — CID 123433005
tert-butyl 5-[methoxy(methyl)amino]-5-oxo-4-[(2-phenylacetyl)amino]pentanoate (PubChem CID 123433005) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is tert-butyl 5-[methoxy(methyl)amino]-5-oxo-4-[(2-phenylacetyl)amino]pentanoate.
| Compound Name | tert-butyl 5-[methoxy(methyl)amino]-5-oxo-4-[(2-phenylacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 123433005 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | tert-butyl 5-[methoxy(methyl)amino]-5-oxo-4-[(2-phenylacetyl)amino]pentanoate |
| SMILES | CON(C)C(=O)C(CCC(=O)OC(C)(C)C)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H28N2O5/c1-19(2,3)26-17(23)12-11-15(18(24)21(4)25-5)20-16(22)13-14-9-7-6-8-10-14/h6-10,15H,11-13H2,1-5H3,(H,20,22) |
| InChIKey | HUZVDJWPVXLHDT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|