C19H29N3O4S2 — CID 123433347
N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-[[3-(propyldisulfanyl)propanoylamino]methyl]cyclopentane-1-carboxamide (PubChem CID 123433347) has the molecular formula C19H29N3O4S2 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-[[3-(propyldisulfanyl)propanoylamino]methyl]cyclopentane-1-carboxamide.
| Compound Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-[[3-(propyldisulfanyl)propanoylamino]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 123433347 |
| Molecular Formula | C19H29N3O4S2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3-[[3-(propyldisulfanyl)propanoylamino]methyl]cyclopentane-1-carboxamide |
| SMILES | CCCSSCCC(=O)NCC1CCC(C(=O)NCCN2C(=O)C=CC2=O)C1 |
| InChI | InChI=1S/C19H29N3O4S2/c1-2-10-27-28-11-7-16(23)21-13-14-3-4-15(12-14)19(26)20-8-9-22-17(24)5-6-18(22)25/h5-6,14-15H,2-4,7-13H2,1H3,(H,20,26)(H,21,23) |
| InChIKey | FRHGDSSRTJHZIF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|