C36H32 — CID 123434351
9-(2-cyclohexa-1,3-dien-1-ylethynyl)-12,12,22,22-tetramethylhexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,7,9,14,16,18,20,23-decaene (PubChem CID 123434351) has the molecular formula C36H32 and a molecular weight of 464.65 g/mol. Its IUPAC name is 9-(2-cyclohexa-1,3-dien-1-ylethynyl)-12,12,22,22-tetramethylhexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,7,9,14,16,18,20,23-decaene.
| Compound Name | 9-(2-cyclohexa-1,3-dien-1-ylethynyl)-12,12,22,22-tetramethylhexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,7,9,14,16,18,20,23-decaene |
|---|---|
| PubChem CID | 123434351 |
| Molecular Formula | C36H32 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 9-(2-cyclohexa-1,3-dien-1-ylethynyl)-12,12,22,22-tetramethylhexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,7,9,14,16,18,20,23-decaene |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)-c1c(cc(C#CC2=CC=CCC2)c2c1=CCCC=2)C3(C)C |
| InChI | InChI=1S/C36H32/c1-35(2)30-17-11-10-15-26(30)28-21-32-29(22-31(28)35)34-27-16-9-8-14-25(27)24(20-33(34)36(32,3)4)19-18-23-12-6-5-7-13-23/h5-6,10-12,14-17,20-22H,7-9,13H2,1-4H3 |
| InChIKey | XYCUISVGJSWIJS-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|