C12H21N — CID 123439151
4-tert-butyl-3,5-dimethylhexa-3,5-dien-2-imine (PubChem CID 123439151) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 4-tert-butyl-3,5-dimethylhexa-3,5-dien-2-imine.
| Compound Name | 4-tert-butyl-3,5-dimethylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 123439151 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 4-tert-butyl-3,5-dimethylhexa-3,5-dien-2-imine |
| SMILES | [H]/N=C(\C)C(C)=C(C(=C)C)C(C)(C)C |
| InChI | InChI=1S/C12H21N/c1-8(2)11(12(5,6)7)9(3)10(4)13/h13H,1H2,2-7H3/b11-9?,13-10+ |
| InChIKey | LGBZLYNGQZRWMU-NZERBSIVSA-N |
| XLogP | 3.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|