C18H27N3O4 — CID 123452489
3-[3-[(1-aminocyclopentyl)methyl]-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione (PubChem CID 123452489) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-[3-[(1-aminocyclopentyl)methyl]-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[(1-aminocyclopentyl)methyl]-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 123452489 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 3-[3-[(1-aminocyclopentyl)methyl]-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione |
| SMILES | CCCc1c(CC2(N)CCCC2)c(O)n(C2CCC(=O)NC2=O)c1O |
| InChI | InChI=1S/C18H27N3O4/c1-2-5-11-12(10-18(19)8-3-4-9-18)17(25)21(16(11)24)13-6-7-14(22)20-15(13)23/h13,24-25H,2-10,19H2,1H3,(H,20,22,23) |
| InChIKey | LDFIOGILJJXOEZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|