C11H12N2O4 — CID 90875092
3-(2,4-dihydroxy-3-azabicyclo[3.2.0]hepta-1,4-dien-3-yl)piperidine-2,6-dione (PubChem CID 90875092) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-(2,4-dihydroxy-3-azabicyclo[3.2.0]hepta-1,4-dien-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(2,4-dihydroxy-3-azabicyclo[3.2.0]hepta-1,4-dien-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 90875092 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-(2,4-dihydroxy-3-azabicyclo[3.2.0]hepta-1,4-dien-3-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c(O)c3c(c2O)CC3)C(=O)N1 |
| InChI | InChI=1S/C11H12N2O4/c14-8-4-3-7(9(15)12-8)13-10(16)5-1-2-6(5)11(13)17/h7,16-17H,1-4H2,(H,12,14,15) |
| InChIKey | WUBQKFASSDREFZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|