C20H32N2O4 — CID 123978092
3-[3-(3-ethyl-3-methylpentyl)-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione (PubChem CID 123978092) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[3-(3-ethyl-3-methylpentyl)-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-(3-ethyl-3-methylpentyl)-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 123978092 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 3-[3-(3-ethyl-3-methylpentyl)-2,5-dihydroxy-4-propylpyrrol-1-yl]piperidine-2,6-dione |
| SMILES | CCCc1c(CCC(C)(CC)CC)c(O)n(C2CCC(=O)NC2=O)c1O |
| InChI | InChI=1S/C20H32N2O4/c1-5-8-13-14(11-12-20(4,6-2)7-3)19(26)22(18(13)25)15-9-10-16(23)21-17(15)24/h15,25-26H,5-12H2,1-4H3,(H,21,23,24) |
| InChIKey | CJGNLMBHMSAQMP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|