C25H41I2N5O2 — CID 123454320
tert-butyl 4-[4,5-bis(2-iodo-2-pyrrolidin-1-ylethyl)-1H-imidazol-2-yl]piperidine-1-carboxylate (PubChem CID 123454320) has the molecular formula C25H41I2N5O2 and a molecular weight of 697.44 g/mol. Its IUPAC name is tert-butyl 4-[4,5-bis(2-iodo-2-pyrrolidin-1-ylethyl)-1H-imidazol-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4,5-bis(2-iodo-2-pyrrolidin-1-ylethyl)-1H-imidazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123454320 |
| Molecular Formula | C25H41I2N5O2 |
| Molecular Weight | 697.44 g/mol |
| Exact Mass | 697.13 |
| IUPAC Name | tert-butyl 4-[4,5-bis(2-iodo-2-pyrrolidin-1-ylethyl)-1H-imidazol-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc(CC(I)N3CCCC3)c(CC(I)N3CCCC3)[nH]2)CC1 |
| InChI | InChI=1S/C25H41I2N5O2/c1-25(2,3)34-24(33)32-14-8-18(9-15-32)23-28-19(16-21(26)30-10-4-5-11-30)20(29-23)17-22(27)31-12-6-7-13-31/h18,21-22H,4-17H2,1-3H3,(H,28,29) |
| InChIKey | VMMJPAMHXPKUDU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|