C31H49NO2 — CID 123455969
2-[5-[3-(methylamino)-4-[1-(6-methylcyclohex-2-en-1-yl)heptan-4-yl]cyclohexa-1,5-dien-1-yl]-5-oxopentyl]cyclopentan-1-one (PubChem CID 123455969) has the molecular formula C31H49NO2 and a molecular weight of 467.74 g/mol. Its IUPAC name is 2-[5-[3-(methylamino)-4-[1-(6-methylcyclohex-2-en-1-yl)heptan-4-yl]cyclohexa-1,5-dien-1-yl]-5-oxopentyl]cyclopentan-1-one.
| Compound Name | 2-[5-[3-(methylamino)-4-[1-(6-methylcyclohex-2-en-1-yl)heptan-4-yl]cyclohexa-1,5-dien-1-yl]-5-oxopentyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 123455969 |
| Molecular Formula | C31H49NO2 |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 467.38 |
| IUPAC Name | 2-[5-[3-(methylamino)-4-[1-(6-methylcyclohex-2-en-1-yl)heptan-4-yl]cyclohexa-1,5-dien-1-yl]-5-oxopentyl]cyclopentan-1-one |
| SMILES | CCCC(CCCC1C=CCCC1C)C1C=CC(C(=O)CCCCC2CCCC2=O)=CC1NC |
| InChI | InChI=1S/C31H49NO2/c1-4-11-25(16-9-15-24-13-6-5-12-23(24)2)28-21-20-27(22-29(28)32-3)31(34)18-8-7-14-26-17-10-19-30(26)33/h6,13,20-26,28-29,32H,4-5,7-12,14-19H2,1-3H3 |
| InChIKey | SDTPELCCVNAKTN-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|