C12H14N2 — CID 123461897
4,7-dimethyl-1-benzazepin-4-amine (PubChem CID 123461897) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 4,7-dimethyl-1-benzazepin-4-amine.
| Compound Name | 4,7-dimethyl-1-benzazepin-4-amine |
|---|---|
| PubChem CID | 123461897 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4,7-dimethyl-1-benzazepin-4-amine |
| SMILES | Cc1ccc2c(c1)=CC(C)(N)C=CN=2 |
| InChI | InChI=1S/C12H14N2/c1-9-3-4-11-10(7-9)8-12(2,13)5-6-14-11/h3-8H,13H2,1-2H3 |
| InChIKey | ZZYSPKYMRDUVSC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |