C12H19F3N2O — CID 123467636
2-(dimethylamino)-7-methyl-4-(trifluoromethyl)octa-2,4-dienamide (PubChem CID 123467636) has the molecular formula C12H19F3N2O and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-(dimethylamino)-7-methyl-4-(trifluoromethyl)octa-2,4-dienamide.
| Compound Name | 2-(dimethylamino)-7-methyl-4-(trifluoromethyl)octa-2,4-dienamide |
|---|---|
| PubChem CID | 123467636 |
| Molecular Formula | C12H19F3N2O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-(dimethylamino)-7-methyl-4-(trifluoromethyl)octa-2,4-dienamide |
| SMILES | CC(C)CC=C(C=C(C(N)=O)N(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H19F3N2O/c1-8(2)5-6-9(12(13,14)15)7-10(11(16)18)17(3)4/h6-8H,5H2,1-4H3,(H2,16,18) |
| InChIKey | YGFQFKYAIPCXCQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|