C17H28N4O2 — CID 123471821
2-(ethylamino)-4,6-dimethyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol (PubChem CID 123471821) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-(ethylamino)-4,6-dimethyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol.
| Compound Name | 2-(ethylamino)-4,6-dimethyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol |
|---|---|
| PubChem CID | 123471821 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2-(ethylamino)-4,6-dimethyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol |
| SMILES | CCNc1nc(C)c2c(n1)N(CCCOC(C)C)C(O)C(C)=C2 |
| InChI | InChI=1S/C17H28N4O2/c1-6-18-17-19-13(5)14-10-12(4)16(22)21(15(14)20-17)8-7-9-23-11(2)3/h10-11,16,22H,6-9H2,1-5H3,(H,18,19,20) |
| InChIKey | XZVWQEOOMWLYRD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|