C23H30N2O4 — CID 123475279
12-ethyl-10-hydroxy-10-(hydroxymethyl)-5-methoxy-8,9-dimethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-one (PubChem CID 123475279) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 12-ethyl-10-hydroxy-10-(hydroxymethyl)-5-methoxy-8,9-dimethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-one.
| Compound Name | 12-ethyl-10-hydroxy-10-(hydroxymethyl)-5-methoxy-8,9-dimethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-one |
|---|---|
| PubChem CID | 123475279 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 12-ethyl-10-hydroxy-10-(hydroxymethyl)-5-methoxy-8,9-dimethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-11-one |
| SMILES | CCC12C=CCN3CCC4(c5ccc(OC)cc5N(C)C4(C)C(O)(CO)C1=O)C32 |
| InChI | InChI=1S/C23H30N2O4/c1-5-21-9-6-11-25-12-10-22(18(21)25)16-8-7-15(29-4)13-17(16)24(3)20(22,2)23(28,14-26)19(21)27/h6-9,13,18,26,28H,5,10-12,14H2,1-4H3 |
| InChIKey | KXCIUFOLRJSQSZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|