C31H37OP — CID 123479005
1-[2-(2-benzyl-4-ethyl-6-methylphenyl)phenyl]-2,2,6,6-tetramethylphosphinan-4-one (PubChem CID 123479005) has the molecular formula C31H37OP and a molecular weight of 456.61 g/mol. Its IUPAC name is 1-[2-(2-benzyl-4-ethyl-6-methylphenyl)phenyl]-2,2,6,6-tetramethylphosphinan-4-one.
| Compound Name | 1-[2-(2-benzyl-4-ethyl-6-methylphenyl)phenyl]-2,2,6,6-tetramethylphosphinan-4-one |
|---|---|
| PubChem CID | 123479005 |
| Molecular Formula | C31H37OP |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 1-[2-(2-benzyl-4-ethyl-6-methylphenyl)phenyl]-2,2,6,6-tetramethylphosphinan-4-one |
| SMILES | CCc1cc(C)c(-c2ccccc2P2C(C)(C)CC(=O)CC2(C)C)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C31H37OP/c1-7-23-17-22(2)29(25(18-23)19-24-13-9-8-10-14-24)27-15-11-12-16-28(27)33-30(3,4)20-26(32)21-31(33,5)6/h8-18H,7,19-21H2,1-6H3 |
| InChIKey | FDCJXRTVIXNBPF-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|