C15H15N — CID 123480096
10-azatetracyclo[7.6.1.01,11.05,16]hexadeca-2,5,7,10,14-pentaene (PubChem CID 123480096) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 10-azatetracyclo[7.6.1.01,11.05,16]hexadeca-2,5,7,10,14-pentaene.
| Compound Name | 10-azatetracyclo[7.6.1.01,11.05,16]hexadeca-2,5,7,10,14-pentaene |
|---|---|
| PubChem CID | 123480096 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 10-azatetracyclo[7.6.1.01,11.05,16]hexadeca-2,5,7,10,14-pentaene |
| SMILES | C1=CC2N=C3CCC=CC34C=CCC(=C1)C24 |
| InChI | InChI=1S/C15H15N/c1-2-9-15-10-4-6-11-5-3-7-12(14(11)15)16-13(15)8-1/h2-5,7,9-10,12,14H,1,6,8H2 |
| InChIKey | WPTNMOTUNGFMFY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|