C8H14N2 — CID 123482216
(Z)-4-N-methylhept-5-ene-3,4-diimine (PubChem CID 123482216) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (Z)-4-N-methylhept-5-ene-3,4-diimine.
| Compound Name | (Z)-4-N-methylhept-5-ene-3,4-diimine |
|---|---|
| PubChem CID | 123482216 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (Z)-4-N-methylhept-5-ene-3,4-diimine |
| SMILES | [H]/N=C(CC)/C(/C=C\C)=N\C |
| InChI | InChI=1S/C8H14N2/c1-4-6-8(10-3)7(9)5-2/h4,6,9H,5H2,1-3H3/b6-4-,9-7+,10-8- |
| InChIKey | ZHMIZHCFTCYVEM-RHCKXKOZSA-N |
| XLogP | 2.06 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|