C24H30BrN3O3SSi+ — CID 123483592
CID 123483592 (PubChem CID 123483592) has the molecular formula C24H30BrN3O3SSi+ and a molecular weight of 548.58 g/mol.
| Compound Name | CID 123483592 |
|---|---|
| PubChem CID | 123483592 |
| Molecular Formula | C24H30BrN3O3SSi+ |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | — |
| SMILES | COCC(S)C1(C)CC(c2nc3c(ccc4cc(Br)ccc43)[nH]2)[N+]([Si])(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H30BrN3O3SSi/c1-23(2,3)31-22(29)28(33)13-24(4,19(32)12-30-5)11-18(28)21-26-17-9-6-14-10-15(25)7-8-16(14)20(17)27-21/h6-10,18-19,32H,11-13H2,1-5H3,(H,26,27)/q+1 |
| InChIKey | ZUFDLAGHARVBAF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|