C25H28BrN3O2S — CID 123601209
tert-butyl 5-(7-bromo-3H-benzo[e]benzimidazol-2-yl)-1-methyl-4-thia-2-azatricyclo[5.3.0.03,5]decane-2-carboxylate (PubChem CID 123601209) has the molecular formula C25H28BrN3O2S and a molecular weight of 514.49 g/mol. Its IUPAC name is tert-butyl 5-(7-bromo-3H-benzo[e]benzimidazol-2-yl)-1-methyl-4-thia-2-azatricyclo[5.3.0.03,5]decane-2-carboxylate.
| Compound Name | tert-butyl 5-(7-bromo-3H-benzo[e]benzimidazol-2-yl)-1-methyl-4-thia-2-azatricyclo[5.3.0.03,5]decane-2-carboxylate |
|---|---|
| PubChem CID | 123601209 |
| Molecular Formula | C25H28BrN3O2S |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | tert-butyl 5-(7-bromo-3H-benzo[e]benzimidazol-2-yl)-1-methyl-4-thia-2-azatricyclo[5.3.0.03,5]decane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2SC2(c2nc3c(ccc4cc(Br)ccc43)[nH]2)CC2CCCC21C |
| InChI | InChI=1S/C25H28BrN3O2S/c1-23(2,3)31-22(30)29-21-25(32-21,13-15-6-5-11-24(15,29)4)20-27-18-10-7-14-12-16(26)8-9-17(14)19(18)28-20/h7-10,12,15,21H,5-6,11,13H2,1-4H3,(H,27,28) |
| InChIKey | SUDVCUCUUVLBKV-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|