C22H27N7O2 — CID 123483691
N'-(2-amino-8-methoxyquinazolin-4-yl)-2-[7-(1-hydroxyethylamino)-3,4-dihydro-1H-isoquinolin-2-yl]ethanimidamide (PubChem CID 123483691) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is N'-(2-amino-8-methoxyquinazolin-4-yl)-2-[7-(1-hydroxyethylamino)-3,4-dihydro-1H-isoquinolin-2-yl]ethanimidamide.
| Compound Name | N'-(2-amino-8-methoxyquinazolin-4-yl)-2-[7-(1-hydroxyethylamino)-3,4-dihydro-1H-isoquinolin-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 123483691 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N'-(2-amino-8-methoxyquinazolin-4-yl)-2-[7-(1-hydroxyethylamino)-3,4-dihydro-1H-isoquinolin-2-yl]ethanimidamide |
| SMILES | COc1cccc2c(/N=C(\N)CN3CCc4ccc(NC(C)O)cc4C3)nc(N)nc12 |
| InChI | InChI=1S/C22H27N7O2/c1-13(30)25-16-7-6-14-8-9-29(11-15(14)10-16)12-19(23)26-21-17-4-3-5-18(31-2)20(17)27-22(24)28-21/h3-7,10,13,25,30H,8-9,11-12H2,1-2H3,(H4,23,24,26,27,28) |
| InChIKey | DJBZUVNWDAZCHU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|