C18H24N8O — CID 123395496
N'-(2-amino-8-methoxyquinazolin-4-yl)-3-[2-(2-iminoethyl)-5,6-dihydro-4H-pyrimidin-1-yl]propanimidamide (PubChem CID 123395496) has the molecular formula C18H24N8O and a molecular weight of 368.45 g/mol. Its IUPAC name is N'-(2-amino-8-methoxyquinazolin-4-yl)-3-[2-(2-iminoethyl)-5,6-dihydro-4H-pyrimidin-1-yl]propanimidamide.
| Compound Name | N'-(2-amino-8-methoxyquinazolin-4-yl)-3-[2-(2-iminoethyl)-5,6-dihydro-4H-pyrimidin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 123395496 |
| Molecular Formula | C18H24N8O |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N'-(2-amino-8-methoxyquinazolin-4-yl)-3-[2-(2-iminoethyl)-5,6-dihydro-4H-pyrimidin-1-yl]propanimidamide |
| SMILES | [H]/N=C/CC1=NCCCN1CC/C(N)=N/c1nc(N)nc2c(OC)cccc12 |
| InChI | InChI=1S/C18H24N8O/c1-27-13-5-2-4-12-16(13)24-18(21)25-17(12)23-14(20)7-11-26-10-3-9-22-15(26)6-8-19/h2,4-5,8,19H,3,6-7,9-11H2,1H3,(H4,20,21,23,24,25)/b19-8+ |
| InChIKey | KCCAHGUQGSXWOH-UFWORHAWSA-N |
| XLogP | 1.74 |
| TPSA | 138.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|