C21H22N6O2 — CID 169151088
3-[2-[N'-(2-amino-8-methoxyquinazolin-4-yl)carbamimidoyl]cyclopropyl]-N-methylbenzamide (PubChem CID 169151088) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 3-[2-[N'-(2-amino-8-methoxyquinazolin-4-yl)carbamimidoyl]cyclopropyl]-N-methylbenzamide.
| Compound Name | 3-[2-[N'-(2-amino-8-methoxyquinazolin-4-yl)carbamimidoyl]cyclopropyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 169151088 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-[2-[N'-(2-amino-8-methoxyquinazolin-4-yl)carbamimidoyl]cyclopropyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(C2CC2/C(N)=N/c2nc(N)nc3c(OC)cccc23)c1 |
| InChI | InChI=1S/C21H22N6O2/c1-24-20(28)12-6-3-5-11(9-12)14-10-15(14)18(22)26-19-13-7-4-8-16(29-2)17(13)25-21(23)27-19/h3-9,14-15H,10H2,1-2H3,(H,24,28)(H4,22,23,25,26,27) |
| InChIKey | LZPYSBZBSALZJJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|