C21H23N7O — CID 169150948
N'-(2-amino-8-methoxyquinazolin-4-yl)-2-[4,5-bis(ethenyl)-1-methylimidazol-2-yl]cyclopropane-1-carboximidamide (PubChem CID 169150948) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is N'-(2-amino-8-methoxyquinazolin-4-yl)-2-[4,5-bis(ethenyl)-1-methylimidazol-2-yl]cyclopropane-1-carboximidamide.
| Compound Name | N'-(2-amino-8-methoxyquinazolin-4-yl)-2-[4,5-bis(ethenyl)-1-methylimidazol-2-yl]cyclopropane-1-carboximidamide |
|---|---|
| PubChem CID | 169150948 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N'-(2-amino-8-methoxyquinazolin-4-yl)-2-[4,5-bis(ethenyl)-1-methylimidazol-2-yl]cyclopropane-1-carboximidamide |
| SMILES | C=Cc1nc(C2CC2/C(N)=N/c2nc(N)nc3c(OC)cccc23)n(C)c1C=C |
| InChI | InChI=1S/C21H23N7O/c1-5-14-15(6-2)28(3)20(24-14)13-10-12(13)18(22)26-19-11-8-7-9-16(29-4)17(11)25-21(23)27-19/h5-9,12-13H,1-2,10H2,3-4H3,(H4,22,23,25,26,27) |
| InChIKey | IZLJHACNKWALLB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|