C21H25F2N7O — CID 169150735
N'-(2-amino-8-methoxyquinazolin-4-yl)methanimidamide;1-(6-cyclobutyl-3-pyridinyl)-2,2-difluoroethanamine (PubChem CID 169150735) has the molecular formula C21H25F2N7O and a molecular weight of 429.48 g/mol. Its IUPAC name is N'-(2-amino-8-methoxyquinazolin-4-yl)methanimidamide;1-(6-cyclobutyl-3-pyridinyl)-2,2-difluoroethanamine.
| Compound Name | N'-(2-amino-8-methoxyquinazolin-4-yl)methanimidamide;1-(6-cyclobutyl-3-pyridinyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 169150735 |
| Molecular Formula | C21H25F2N7O |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N'-(2-amino-8-methoxyquinazolin-4-yl)methanimidamide;1-(6-cyclobutyl-3-pyridinyl)-2,2-difluoroethanamine |
| SMILES | COc1cccc2c(/N=C/N)nc(N)nc12.NC(c1ccc(C2CCC2)nc1)C(F)F |
| InChI | InChI=1S/C11H14F2N2.C10H11N5O/c12-11(13)10(14)8-4-5-9(15-6-8)7-2-1-3-7;1-16-7-4-2-3-6-8(7)14-10(12)15-9(6)13-5-11/h4-7,10-11H,1-3,14H2;2-5H,1H3,(H4,11,12,13,14,15) |
| InChIKey | PXDSBEUJPOQEFG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|