C20H30N6O — CID 123295175
N'-(2-amino-8-methoxyquinazolin-4-yl)-3-(azepan-1-yl)-2,2-dimethylpropanimidamide (PubChem CID 123295175) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is N'-(2-amino-8-methoxyquinazolin-4-yl)-3-(azepan-1-yl)-2,2-dimethylpropanimidamide.
| Compound Name | N'-(2-amino-8-methoxyquinazolin-4-yl)-3-(azepan-1-yl)-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 123295175 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | N'-(2-amino-8-methoxyquinazolin-4-yl)-3-(azepan-1-yl)-2,2-dimethylpropanimidamide |
| SMILES | COc1cccc2c(/N=C(\N)C(C)(C)CN3CCCCCC3)nc(N)nc12 |
| InChI | InChI=1S/C20H30N6O/c1-20(2,13-26-11-6-4-5-7-12-26)18(21)24-17-14-9-8-10-15(27-3)16(14)23-19(22)25-17/h8-10H,4-7,11-13H2,1-3H3,(H4,21,22,23,24,25) |
| InChIKey | RCAQOROYPZFHCK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|