C17H16N4 — CID 123490148
3-cyclopropyl-2-[5-(methylideneamino)penta-2,4-dien-2-yl]benzimidazole-5-carbonitrile (PubChem CID 123490148) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-cyclopropyl-2-[5-(methylideneamino)penta-2,4-dien-2-yl]benzimidazole-5-carbonitrile.
| Compound Name | 3-cyclopropyl-2-[5-(methylideneamino)penta-2,4-dien-2-yl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 123490148 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-cyclopropyl-2-[5-(methylideneamino)penta-2,4-dien-2-yl]benzimidazole-5-carbonitrile |
| SMILES | C=NC=CC=C(C)c1nc2ccc(C#N)cc2n1C1CC1 |
| InChI | InChI=1S/C17H16N4/c1-12(4-3-9-19-2)17-20-15-8-5-13(11-18)10-16(15)21(17)14-6-7-14/h3-5,8-10,14H,2,6-7H2,1H3 |
| InChIKey | HGJRYYQBNNUNAF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 53.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|