C27H35N8O5+ — CID 123490557
4-[4-[9-methyl-2-[[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]amino]purin-9-ium-9-yl]phenoxy]butanoic acid (PubChem CID 123490557) has the molecular formula C27H35N8O5+ and a molecular weight of 551.63 g/mol. Its IUPAC name is 4-[4-[9-methyl-2-[[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]amino]purin-9-ium-9-yl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[9-methyl-2-[[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]amino]purin-9-ium-9-yl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 123490557 |
| Molecular Formula | C27H35N8O5+ |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 4-[4-[9-methyl-2-[[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]amino]purin-9-ium-9-yl]phenoxy]butanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCn1cc(Nc2ncc3c(n2)[N+](C)(c2ccc(OCCCC(=O)O)cc2)C=N3)cn1 |
| InChI | InChI=1S/C27H34N8O5/c1-27(2,3)40-26(38)28-12-6-13-34-17-19(15-31-34)32-25-29-16-22-24(33-25)35(4,18-30-22)20-8-10-21(11-9-20)39-14-5-7-23(36)37/h8-11,15-18H,5-7,12-14H2,1-4H3,(H2-,28,29,32,33,36,37,38)/p+1 |
| InChIKey | AELMQQUWZRCOCV-UHFFFAOYSA-O |
| XLogP | 4.52 |
| TPSA | 152.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|