C30H34N2O7 — CID 123491015
4-(dimethylamino)-6-[(3,5-dimethylphenyl)methyl]-5,10,12a-trihydroxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 123491015) has the molecular formula C30H34N2O7 and a molecular weight of 534.61 g/mol. Its IUPAC name is 4-(dimethylamino)-6-[(3,5-dimethylphenyl)methyl]-5,10,12a-trihydroxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-6-[(3,5-dimethylphenyl)methyl]-5,10,12a-trihydroxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123491015 |
| Molecular Formula | C30H34N2O7 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 4-(dimethylamino)-6-[(3,5-dimethylphenyl)methyl]-5,10,12a-trihydroxy-3,11,12-trioxo-1,2,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | Cc1cc(C)cc(CC2c3cccc(O)c3C(=O)C3C(=O)C4(O)CC(C(N)=O)C(=O)C(N(C)C)C4C(O)C32)c1 |
| InChI | InChI=1S/C30H34N2O7/c1-13-8-14(2)10-15(9-13)11-17-16-6-5-7-19(33)20(16)26(35)22-21(17)27(36)23-24(32(3)4)25(34)18(29(31)38)12-30(23,39)28(22)37/h5-10,17-18,21-24,27,33,36,39H,11-12H2,1-4H3,(H2,31,38) |
| InChIKey | OLUJFUXLBNYWED-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|