C20H24F4O2 — CID 123497163
5-[2-(4-ethoxy-2,3-difluorophenyl)-1,2-difluoroethenyl]-2-pentyl-3,4-dihydro-2H-pyran (PubChem CID 123497163) has the molecular formula C20H24F4O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is 5-[2-(4-ethoxy-2,3-difluorophenyl)-1,2-difluoroethenyl]-2-pentyl-3,4-dihydro-2H-pyran.
| Compound Name | 5-[2-(4-ethoxy-2,3-difluorophenyl)-1,2-difluoroethenyl]-2-pentyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 123497163 |
| Molecular Formula | C20H24F4O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 5-[2-(4-ethoxy-2,3-difluorophenyl)-1,2-difluoroethenyl]-2-pentyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCC1CCC(C(F)=C(F)c2ccc(OCC)c(F)c2F)=CO1 |
| InChI | InChI=1S/C20H24F4O2/c1-3-5-6-7-14-9-8-13(12-26-14)17(21)18(22)15-10-11-16(25-4-2)20(24)19(15)23/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | IXUYERPVWDHCCF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|