C11H25N2O6S2+ — CID 123500792
3-[4-methyl-4-(3-sulfopropyl)piperazin-4-ium-1-yl]propane-1-sulfonic acid (PubChem CID 123500792) has the molecular formula C11H25N2O6S2+ and a molecular weight of 345.46 g/mol. Its IUPAC name is 3-[4-methyl-4-(3-sulfopropyl)piperazin-4-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-methyl-4-(3-sulfopropyl)piperazin-4-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 123500792 |
| Molecular Formula | C11H25N2O6S2+ |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-[4-methyl-4-(3-sulfopropyl)piperazin-4-ium-1-yl]propane-1-sulfonic acid |
| SMILES | C[N+]1(CCCS(=O)(=O)O)CCN(CCCS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C11H24N2O6S2/c1-13(7-3-11-21(17,18)19)8-5-12(6-9-13)4-2-10-20(14,15)16/h2-11H2,1H3,(H-,14,15,16,17,18,19)/p+1 |
| InChIKey | GRYMNDPDIKWNQL-UHFFFAOYSA-O |
| XLogP | -0.70 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|