C16H32N2O8S2+2 — CID 89082120
3-[1-methyl-4-(2-methylprop-2-enoyloxymethyl)-4-(3-sulfopropyl)piperazine-1,4-diium-1-yl]propane-1-sulfonic acid (PubChem CID 89082120) has the molecular formula C16H32N2O8S2+2 and a molecular weight of 444.57 g/mol. Its IUPAC name is 3-[1-methyl-4-(2-methylprop-2-enoyloxymethyl)-4-(3-sulfopropyl)piperazine-1,4-diium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[1-methyl-4-(2-methylprop-2-enoyloxymethyl)-4-(3-sulfopropyl)piperazine-1,4-diium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89082120 |
| Molecular Formula | C16H32N2O8S2+2 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 3-[1-methyl-4-(2-methylprop-2-enoyloxymethyl)-4-(3-sulfopropyl)piperazine-1,4-diium-1-yl]propane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OC[N+]1(CCCS(=O)(=O)O)CC[N+](C)(CCCS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C16H30N2O8S2/c1-15(2)16(19)26-14-18(7-5-13-28(23,24)25)10-8-17(3,9-11-18)6-4-12-27(20,21)22/h1,4-14H2,2-3H3/p+2 |
| InChIKey | NFLMQXWTSXZDGW-UHFFFAOYSA-P |
| XLogP | -0.10 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|