C27H25N5O3 — CID 123501768
N-[2-[2-[6-[2-[2-(carbamoylamino)phenyl]ethynyl]-4-[2-(dimethylamino)ethoxy]-2-pyridinyl]ethynyl]phenyl]formamide (PubChem CID 123501768) has the molecular formula C27H25N5O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[2-[2-[6-[2-[2-(carbamoylamino)phenyl]ethynyl]-4-[2-(dimethylamino)ethoxy]-2-pyridinyl]ethynyl]phenyl]formamide.
| Compound Name | N-[2-[2-[6-[2-[2-(carbamoylamino)phenyl]ethynyl]-4-[2-(dimethylamino)ethoxy]-2-pyridinyl]ethynyl]phenyl]formamide |
|---|---|
| PubChem CID | 123501768 |
| Molecular Formula | C27H25N5O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[2-[2-[6-[2-[2-(carbamoylamino)phenyl]ethynyl]-4-[2-(dimethylamino)ethoxy]-2-pyridinyl]ethynyl]phenyl]formamide |
| SMILES | CN(C)CCOc1cc(C#Cc2ccccc2NC=O)nc(C#Cc2ccccc2NC(N)=O)c1 |
| InChI | InChI=1S/C27H25N5O3/c1-32(2)15-16-35-24-17-22(13-11-20-7-3-5-9-25(20)29-19-33)30-23(18-24)14-12-21-8-4-6-10-26(21)31-27(28)34/h3-10,17-19H,15-16H2,1-2H3,(H,29,33)(H3,28,31,34) |
| InChIKey | NBOQHZNMMNQXNI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|