About CID 123505294
CID 123505294 (PubChem CID 123505294) has the molecular formula C9H16BNO
and a molecular weight of 165.05 g/mol.
Molecular Properties
| Compound Name | CID 123505294 |
| PubChem CID | 123505294 |
| Molecular Formula | C9H16BNO |
| Molecular Weight | 165.05 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CC(CC)(CCC)C1 |
| InChI | InChI=1S/C9H16BNO/c1-3-5-9(4-2)6-11(7-9)8(10)12/h3-7H2,1-2H3 |
| InChIKey | SKNPJBXWEPKKNC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.05 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123505294 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123505294?
The IUPAC name of CID 123505294 (CID 123505294) is not available.
What is the SMILES notation for CID 123505294?
The canonical SMILES for CID 123505294 is [B]C(=O)N1CC(CC)(CCC)C1.
What is the InChIKey of CID 123505294?
The InChIKey is SKNPJBXWEPKKNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16BNO/c1-3-5-9(4-2)6-11(7-9)8(10)12/h3-7H2,1-2H3.
What are the key properties of CID 123505294?
CID 123505294 has a molecular weight of 165.05 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123505294 is sourced from PubChem (CID 123505294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).