C40H40 — CID 123508067
1-cyclohexa-2,4-dien-1-yl-3-[3-[3-(5-cyclohexa-1,3-dien-1-ylcyclohexa-1,5-dien-1-yl)prop-2-enyl]-5-methylcyclohexa-1,3-dien-1-yl]-5-phenylbenzene (PubChem CID 123508067) has the molecular formula C40H40 and a molecular weight of 520.76 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-3-[3-[3-(5-cyclohexa-1,3-dien-1-ylcyclohexa-1,5-dien-1-yl)prop-2-enyl]-5-methylcyclohexa-1,3-dien-1-yl]-5-phenylbenzene.
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-3-[3-[3-(5-cyclohexa-1,3-dien-1-ylcyclohexa-1,5-dien-1-yl)prop-2-enyl]-5-methylcyclohexa-1,3-dien-1-yl]-5-phenylbenzene |
|---|---|
| PubChem CID | 123508067 |
| Molecular Formula | C40H40 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-3-[3-[3-(5-cyclohexa-1,3-dien-1-ylcyclohexa-1,5-dien-1-yl)prop-2-enyl]-5-methylcyclohexa-1,3-dien-1-yl]-5-phenylbenzene |
| SMILES | CC1C=C(CC=CC2=CCCC(C3=CC=CCC3)=C2)C=C(c2cc(-c3ccccc3)cc(C3C=CC=CC3)c2)C1 |
| InChI | InChI=1S/C40H40/c1-30-23-32(15-11-13-31-14-12-22-36(25-31)33-16-5-2-6-17-33)26-37(24-30)40-28-38(34-18-7-3-8-19-34)27-39(29-40)35-20-9-4-10-21-35/h2-5,7-11,13-14,16,18-20,23,25-30,35H,6,12,15,17,21-22,24H2,1H3 |
| InChIKey | AZNGKGABBGENRQ-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |