C53H50N8O3 — CID 123509365
ethyl 4-[[4-benzyl-6-[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate;4-[[4-(4-methylanilino)-6-[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]methyl]benzaldehyde (PubChem CID 123509365) has the molecular formula C53H50N8O3 and a molecular weight of 847.04 g/mol. Its IUPAC name is ethyl 4-[[4-benzyl-6-[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate;4-[[4-(4-methylanilino)-6-[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]methyl]benzaldehyde.
| Compound Name | ethyl 4-[[4-benzyl-6-[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate;4-[[4-(4-methylanilino)-6-[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 123509365 |
| Molecular Formula | C53H50N8O3 |
| Molecular Weight | 847.04 g/mol |
| Exact Mass | 846.40 |
| IUPAC Name | ethyl 4-[[4-benzyl-6-[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate;4-[[4-(4-methylanilino)-6-[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]methyl]benzaldehyde |
| SMILES | CCOC(=O)c1ccc(Nc2nc(Cc3ccccc3)nc(Cc3cccc(C)c3)n2)cc1.Cc1ccc(Nc2nc(Cc3ccc(C=O)cc3)nc(Cc3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C27H26N4O2.C26H24N4O/c1-3-33-26(32)22-12-14-23(15-13-22)28-27-30-24(17-20-9-5-4-6-10-20)29-25(31-27)18-21-11-7-8-19(2)16-21;1-18-6-12-23(13-7-18)27-26-29-24(15-20-8-10-21(17-31)11-9-20)28-25(30-26)16-22-5-3-4-19(2)14-22/h4-16H,3,17-18H2,1-2H3,(H,28,29,30,31);3-14,17H,15-16H2,1-2H3,(H,27,28,29,30) |
| InChIKey | XFJDXDPVYWEOLA-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.04 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|