C17H28N6O2 — CID 123513264
tert-butyl 3-[(6-amino-5-propanimidoylpyrimidin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 123513264) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is tert-butyl 3-[(6-amino-5-propanimidoylpyrimidin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-amino-5-propanimidoylpyrimidin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123513264 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | tert-butyl 3-[(6-amino-5-propanimidoylpyrimidin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | [H]/N=C(\CC)c1c(N)ncnc1NC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H28N6O2/c1-5-12(18)13-14(19)20-10-21-15(13)22-11-7-6-8-23(9-11)16(24)25-17(2,3)4/h10-11,18H,5-9H2,1-4H3,(H3,19,20,21,22)/b18-12+ |
| InChIKey | SCKCTDBNJNCJIU-LDADJPATSA-N |
| XLogP | 2.65 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|