C19H32O4 — CID 123518992
7,7-dimethyl-5-(3-methylpenta-1,3-dienyl)-4-(2-propoxyethoxy)-1,6-dioxaspiro[2.5]octane (PubChem CID 123518992) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is 7,7-dimethyl-5-(3-methylpenta-1,3-dienyl)-4-(2-propoxyethoxy)-1,6-dioxaspiro[2.5]octane.
| Compound Name | 7,7-dimethyl-5-(3-methylpenta-1,3-dienyl)-4-(2-propoxyethoxy)-1,6-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 123518992 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 7,7-dimethyl-5-(3-methylpenta-1,3-dienyl)-4-(2-propoxyethoxy)-1,6-dioxaspiro[2.5]octane |
| SMILES | CC=C(C)C=CC1OC(C)(C)CC2(CO2)C1OCCOCCC |
| InChI | InChI=1S/C19H32O4/c1-6-10-20-11-12-21-17-16(9-8-15(3)7-2)23-18(4,5)13-19(17)14-22-19/h7-9,16-17H,6,10-14H2,1-5H3 |
| InChIKey | WADHQADGEULYIJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|